ChemNet > CAS > 41306-29-0 2-[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolan-5-yl]acetic acid
41306-29-0 2-[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolan-5-yl]acetic acid
| product Name |
2-[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolan-5-yl]acetic acid |
| CAS No |
41306-29-0 |
| Synonyms |
[(2Z)-3-methyl-2-(methylimino)-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| Molecular Formula |
C7H10N2O3S |
| Molecular Weight |
202.2309 |
| InChI |
InChI=1/C7H10N2O3S/c1-8-7-9(2)6(12)4(13-7)3-5(10)11/h4H,3H2,1-2H3,(H,10,11)/b8-7- |
| Molecular Structure |
|
| Density |
1.47g/cm3 |
| Melting point |
158℃ |
| Boiling point |
374.5°C at 760 mmHg |
| Refractive index |
1.639 |
| Flash point |
180.3°C |
| Vapour Pressur |
1.22E-06mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|